EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H45N3O5 |
| Net Charge | 0 |
| Average Mass | 515.695 |
| Monoisotopic Mass | 515.33592 |
| SMILES | CCCCCCC(C)C1CC(=O)NC(Cc2ccccc2)C(=O)NC(C)C(=O)NC(C(C)CC)C(=O)O1 |
| InChI | InChI=1S/C29H45N3O5/c1-6-8-9-11-14-20(4)24-18-25(33)31-23(17-22-15-12-10-13-16-22)28(35)30-21(5)27(34)32-26(19(3)7-2)29(36)37-24/h10,12-13,15-16,19-21,23-24,26H,6-9,11,14,17-18H2,1-5H3,(H,30,35)(H,31,33)(H,32,34) |
| InChIKey | LJKNHIBJQYSBGK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria tenella (ncbitaxon:37999) | - | DOI (10.1016/s0031-9422(00)90402-3) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Beauverolide-La (CHEBI:218510) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 9-benzyl-3-butan-2-yl-6-methyl-13-octan-2-yl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 78444320 | ChemSpider |