EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N4O2 |
| Net Charge | 0 |
| Average Mass | 188.231 |
| Monoisotopic Mass | 188.12733 |
| SMILES | CN(CCC[C@H](N)C(=O)O)C(=N)N |
| InChI | InChI=1S/C7H16N4O2/c1-11(7(9)10)4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H3,9,10)(H,12,13)/t5-/m0/s1 |
| InChIKey | XKCWNEVAXQCMGP-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-methyl-L-arginine (CHEBI:21848) is a L-arginine derivative (CHEBI:83965) |
| N5-methyl-L-arginine (CHEBI:21848) is a guanidines (CHEBI:24436) |
| N5-methyl-L-arginine (CHEBI:21848) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| N5-carbamimidoyl-N5-methyl-L-ornithine |
| Synonyms | Source |
|---|---|
| δ-N-methylarginine | ChEBI |
| delta-N-Methylarginine | ChemIDplus |
| (2S)-2-amino-5-(N-methylcarbamimidamido)pentanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4992308 | Beilstein |
| CAS:77044-73-6 | ChemIDplus |