EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | COC(=O)c1c(C(=O)O)cc(OCC=C(C)C)c(C)c1OC |
| InChI | InChI=1S/C16H20O6/c1-9(2)6-7-22-12-8-11(15(17)18)13(16(19)21-5)14(20-4)10(12)3/h6,8H,7H2,1-5H3,(H,17,18) |
| InChIKey | JHZWDWULMWXMAU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis photiniae (ncbitaxon:289238) | - | PubMed (21915132) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(3',3'-dimethylallyloxy)-2-methoxycarbonyl-3-methoxy-4-methylbenzoic acid (CHEBI:218450) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 3-methoxy-2-methoxycarbonyl-4-methyl-5-(3-methylbut-2-enoxy)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434893 | ChemSpider |