EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46N6O9 |
| Net Charge | 0 |
| Average Mass | 646.742 |
| Monoisotopic Mass | 646.33263 |
| SMILES | COCC(=O)N[C@@H](C(=O)N1NCCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)[C@H](C)C(=O)N[C@H]1CCC(=O)NC1=O)[C@H](O)C(C)C |
| InChI | InChI=1S/C31H46N6O9/c1-17(2)26(40)25(35-24(39)16-46-4)31(45)37-22(11-8-14-32-37)30(44)34-21(15-19-9-6-5-7-10-19)27(41)18(3)28(42)33-20-12-13-23(38)36-29(20)43/h5-7,9-10,17-18,20-22,25-27,32,40-41H,8,11-16H2,1-4H3,(H,33,42)(H,34,44)(H,35,39)(H,36,38,43)/t18-,20-,21-,22-,25+,26+,27-/m0/s1 |
| InChIKey | HVEJTNNFGWKHNS-GYNFZRGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (21749075) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Padanamide B (CHEBI:218419) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S)-N-[(2S,3S,4S)-5-[[(3S)-2,6-dioxopiperidin-3-yl]amino]-3-hydroxy-4-methyl-5-oxo-1-phenylpentan-2-yl]-2-[(2R,3R)-3-hydroxy-2-[(2-methoxyacetyl)amino]-4-methylpentanoyl]diazinane-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 28185040 | ChemSpider |