EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O7 |
| Net Charge | 0 |
| Average Mass | 308.286 |
| Monoisotopic Mass | 308.08960 |
| SMILES | COC(=O)c1cc(OC)c(O)c2oc(C[C@H](C)O)cc(=O)c12 |
| InChI | InChI=1S/C15H16O7/c1-7(16)4-8-5-10(17)12-9(15(19)21-3)6-11(20-2)13(18)14(12)22-8/h5-7,16,18H,4H2,1-3H3/t7-/m0/s1 |
| InChIKey | FOHOTYGWIQNHKY-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies SCSIO XWS03F03 (ncbitaxon:1836588) | - | PubMed (28276769) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergchromone B (CHEBI:218413) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| methyl 8-hydroxy-2-[(2S)-2-hydroxypropyl]-7-methoxy-4-oxochromene-5-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78441821 | ChemSpider |