EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7N3O |
| Net Charge | 0 |
| Average Mass | 125.131 |
| Monoisotopic Mass | 125.05891 |
| SMILES | CNc1ccnc(=O)n1 |
| InChI | InChI=1S/C5H7N3O/c1-6-4-2-3-7-5(9)8-4/h2-3H,1H3,(H2,6,7,8,9) |
| InChIKey | PJKKQFAEFWCNAQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N4-methylcytosine (CHEBI:21839) has functional parent cytosine (CHEBI:16040) |
| N4-methylcytosine (CHEBI:21839) has role metabolite (CHEBI:25212) |
| N4-methylcytosine (CHEBI:21839) is a aminopyrimidine (CHEBI:38338) |
| N4-methylcytosine (CHEBI:21839) is a methylcytosine (CHEBI:134207) |
| N4-methylcytosine (CHEBI:21839) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 4-(methylamino)pyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| N(4)-Methylcytosine | ChEBI |
| 4-methylamino-1H-pyrimidin-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:115722 | Reaxys |
| CAS:6220-47-9 | ChemIDplus |
| Citations |
|---|