EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H47NO4 |
| Net Charge | 0 |
| Average Mass | 413.643 |
| Monoisotopic Mass | 413.35051 |
| SMILES | CCCCCCCCCCC[C@@H](OC(=O)CCCCCCC)[C@@H](C)NCC(=O)O |
| InChI | InChI=1S/C24H47NO4/c1-4-6-8-10-11-12-13-15-16-18-22(21(3)25-20-23(26)27)29-24(28)19-17-14-9-7-5-2/h21-22,25H,4-20H2,1-3H3,(H,26,27)/t21-,22-/m1/s1 |
| InChIKey | APRNIWNRXVDZQP-FGZHOGPDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusariumspecies (ncbitaxon:29916) | - | DOI (10.1177/1934578X1801300108) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusariumin B (CHEBI:218328) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-[[(2R,3R)-3-octanoyloxytetradecan-2-yl]amino]acetic acid |