EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17NO3 |
| Net Charge | 0 |
| Average Mass | 283.327 |
| Monoisotopic Mass | 283.12084 |
| SMILES | CN(C(=O)CCc1ccccc1)c1ccccc1C(=O)O |
| InChI | InChI=1S/C17H17NO3/c1-18(15-10-6-5-9-14(15)17(20)21)16(19)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,20,21) |
| InChIKey | APLMLPAZZRMWPT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (9589070) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[methyl-(3-phenylpropionyl)lamino]-benzoic acid (CHEBI:218279) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2-[methyl(3-phenylpropanoyl)amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8716332 | ChemSpider |
| HMDB0032845 | HMDB |