EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O3 |
| Net Charge | 0 |
| Average Mass | 216.236 |
| Monoisotopic Mass | 216.07864 |
| SMILES | C=C(C)C#Cc1cc(C(=O)O)ccc1OC |
| InChI | InChI=1S/C13H12O3/c1-9(2)4-5-10-8-11(13(14)15)6-7-12(10)16-3/h6-8H,1H2,2-3H3,(H,14,15) |
| InChIKey | BZUCIVANDDTNAW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25375978) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergillusic acid (CHEBI:218239) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 4-methoxy-3-(3-methylbut-3-en-1-ynyl)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434891 | ChemSpider |