EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O3 |
| Net Charge | 0 |
| Average Mass | 220.228 |
| Monoisotopic Mass | 220.08479 |
| SMILES | CC(=O)/C(C)=N\Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C11H12N2O3/c1-7(8(2)14)12-13-10-6-4-3-5-9(10)11(15)16/h3-6,13H,1-2H3,(H,15,16)/b12-7- |
| InChIKey | JECLOJBKLSSTCO-GHXNOFRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies HDN14-431 (ncbitaxon:1824893) | - | PubMed (27249624) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Farylhydrazone C (CHEBI:218233) is a benzoic acids (CHEBI:22723) |