EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H33N3O7 |
| Net Charge | 0 |
| Average Mass | 619.674 |
| Monoisotopic Mass | 619.23185 |
| SMILES | C=CC(C)(C)c1nc2ccccc2c1/C=C1\NC(=O)[C@@]2(CC[C@@]3(O)c4cc(C)cc(O)c4C(=O)c4c(O)cc(OC)c2c43)NC1=O |
| InChI | InChI=1S/C36H33N3O7/c1-6-34(3,4)31-19(18-9-7-8-10-21(18)37-31)15-22-32(43)39-35(33(44)38-22)11-12-36(45)20-13-17(2)14-23(40)26(20)30(42)27-24(41)16-25(46-5)28(35)29(27)36/h6-10,13-16,37,40-41,45H,1,11-12H2,2-5H3,(H,38,44)(H,39,43)/b22-15-/t35-,36+/m0/s1 |
| InChIKey | QJNGRMBNUUTRKF-OOVNXVSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurotiumspecies SCSIO F452 (ncbitaxon:1246140) | - | PubMed (30011219) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-variecolortin C (CHEBI:218230) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (3S,6'Z,11bR)-6,8,11b-trihydroxy-4-methoxy-10-methyl-6'-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]spiro[1,2-dihydrobenzo[a]phenalene-3,3'-piperazine]-2',5',7-trione |
| Manual Xrefs | Databases |
|---|---|
| 68007486 | ChemSpider |