EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13NO4 |
| Net Charge | 0 |
| Average Mass | 259.261 |
| Monoisotopic Mass | 259.08446 |
| SMILES | C[C@@]1(CO)C=Cc2c(ccc3c(C(=O)O)cnc23)O1 |
| InChI | InChI=1S/C14H13NO4/c1-14(7-16)5-4-9-11(19-14)3-2-8-10(13(17)18)6-15-12(8)9/h2-6,15-16H,7H2,1H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | RNQOSFLKODNGRK-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies HDN14-431 (ncbitaxon:1824893) | - | PubMed (27249624) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Exopisiod B (CHEBI:218228) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (7S)-7-(hydroxymethyl)-7-methyl-1H-pyrano[2,3-g]indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441799 | ChemSpider |