EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O3 |
| Net Charge | 0 |
| Average Mass | 306.361 |
| Monoisotopic Mass | 306.12559 |
| SMILES | COc1cccc2cc3c4c(ccc3cc12)C[C@](C)(O)CC4=O |
| InChI | InChI=1S/C20H18O3/c1-20(22)10-14-7-6-13-8-15-12(4-3-5-18(15)23-2)9-16(13)19(14)17(21)11-20/h3-9,22H,10-11H2,1-2H3/t20-/m0/s1 |
| InChIKey | ROQRYDSBEWKMJK-FQEVSTJZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies W007 (ncbitaxon:1055352) | - | PubMed (22131954) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-1-keto-3-methyl-8-methoxy-1,2,3, 4-tetrahydro-benz[alpha]anthracene (CHEBI:218201) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 3-hydroxy-8-methoxy-3-methyl-2,4-dihydrobenzo[a]anthracen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 27025692 | ChemSpider |