EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H30O14 |
| Net Charge | 0 |
| Average Mass | 638.578 |
| Monoisotopic Mass | 638.16356 |
| SMILES | COc1cc(O)c2c(c1)C(=O)C1=C(C2=O)[C@@H]([C@@H]2C3=C(C(=O)c4cc(OC)cc(O)c4C3=O)[C@@H](O)[C@](C)(O)[C@@H]2O)[C@@H](O)[C@@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C32H30O14/c1-31(43)27(39)19(17-21(29(31)41)23(35)11-5-9(45-3)7-13(33)15(11)25(17)37)20-18-22(30(42)32(2,44)28(20)40)24(36)12-6-10(46-4)8-14(34)16(12)26(18)38/h5-8,19-20,27-30,33-34,39-44H,1-4H3/t19-,20-,27+,28+,29+,30+,31+,32+/m0/s1 |
| InChIKey | WWOFACZMDGHQHR-VGKOLKNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternariaspecies ZJ-2008003 (ncbitaxon:1081808) | - | PubMed (22276679) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alterporriol O (CHEBI:218125) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| (1R,2R,3R,4R)-2,3,4,8-tetrahydroxy-6-methoxy-3-methyl-1-[(1R,2R,3R,4R)-2,3,4,8-tetrahydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-1-yl]-2,4-dihydro-1H-anthracene-9,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 29214727 | ChemSpider |