EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O7 |
| Net Charge | 0 |
| Average Mass | 392.448 |
| Monoisotopic Mass | 392.18350 |
| SMILES | CCCCC/C=C/C1=C(COC(C)=O)[C@@H](O)[C@H]2O[C@@]2(C/C=C(\C)C(=O)O)C1=O |
| InChI | InChI=1S/C21H28O7/c1-4-5-6-7-8-9-15-16(12-27-14(3)22)17(23)19-21(28-19,18(15)24)11-10-13(2)20(25)26/h8-10,17,19,23H,4-7,11-12H2,1-3H3,(H,25,26)/b9-8+,13-10+/t17-,19-,21+/m1/s1 |
| InChIKey | FUWUXINGPGJNLY-XCWDVTCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Multiclavulaspecies (ncbitaxon:2506259) | - | PubMed (19117486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-[(1R,5R,6R)-4-(acetyloxymethyl)-3-[(E)-hept-1-enyl]-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoic acid (CHEBI:218094) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (E)-4-[(1R,5R,6R)-4-(acetyloxymethyl)-3-[(E)-hept-1-enyl]-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24625607 | ChemSpider |