EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO5 |
| Net Charge | 0 |
| Average Mass | 201.178 |
| Monoisotopic Mass | 201.06372 |
| SMILES | CC(=O)NC1=C[C@@H]([C@H](O)CO)OC1=O |
| InChI | InChI=1S/C8H11NO5/c1-4(11)9-5-2-7(6(12)3-10)14-8(5)13/h2,6-7,10,12H,3H2,1H3,(H,9,11)/t6-,7+/m1/s1 |
| InChIKey | XBJZBELDKOKZKH-RQJHMYQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leptosphaeriaspecies (ncbitaxon:1755431) | - | DOI (10.1016/s0040-4039(00)85272-7) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leptosphaerin (CHEBI:218081) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(2S)-2-[(1R)-1,2-dihydroxyethyl]-5-oxo-2H-uran-4-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 9074920 | ChemSpider |