EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O4 |
| Net Charge | 0 |
| Average Mass | 412.570 |
| Monoisotopic Mass | 412.26136 |
| SMILES | C/C=C(\C)[C@@H]1C(CO)=C[C@@H]2[C@@H](O)[C@@H](C)CC[C@H]2[C@]1(C)/C=C/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C26H36O4/c1-5-18(2)24-20(17-27)16-21-22(14-13-19(3)25(21)30)26(24,4)15-11-9-7-6-8-10-12-23(28)29/h5-12,15-16,19,21-22,24-25,27,30H,13-14,17H2,1-4H3,(H,28,29)/b8-6+,9-7+,12-10+,15-11+,18-5+/t19-,21-,22+,24+,25-,26-/m0/s1 |
| InChIKey | HQBUFDHCDKVRME-GFOUDHLOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Janthinobacterium (ncbitaxon:29580) | - | DOI (10.1016/j.tetlet.2018.08.022) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Janthinopolyenemycin B (CHEBI:218060) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E)-9-[(1S,2S,4aS,5S,6S,8aR)-2-[(E)-but-2-en-2-yl]-5-hydroxy-3-(hydroxymethyl)-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]nona-2,4,6,8-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 68006775 | ChemSpider |