EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O3 |
| Net Charge | 0 |
| Average Mass | 396.571 |
| Monoisotopic Mass | 396.26645 |
| SMILES | C/C=C(\C)[C@@H]1C(C)=C[C@@H]2[C@@H](O)[C@@H](C)CC[C@H]2[C@]1(C)/C=C/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C26H36O3/c1-6-18(2)24-20(4)17-21-22(15-14-19(3)25(21)29)26(24,5)16-12-10-8-7-9-11-13-23(27)28/h6-13,16-17,19,21-22,24-25,29H,14-15H2,1-5H3,(H,27,28)/b9-7+,10-8+,13-11+,16-12+,18-6+/t19-,21-,22+,24+,25-,26-/m0/s1 |
| InChIKey | NRPCUDXRWZSLDT-CBKDNREWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Janthinobacterium (ncbitaxon:29580) | - | DOI (10.1016/j.tetlet.2018.08.022) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Janthinopolyenemycin A (CHEBI:218052) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E)-9-[(1S,2R,4aS,5S,6S,8aR)-2-[(E)-but-2-en-2-yl]-5-hydroxy-1,3,6-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]nona-2,4,6,8-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 68006774 | ChemSpider |