EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13NO3 |
| Net Charge | 0 |
| Average Mass | 243.262 |
| Monoisotopic Mass | 243.08954 |
| SMILES | COC(=O)c1ccc([C@H](O)c2ccccc2)cn1 |
| InChI | InChI=1S/C14H13NO3/c1-18-14(17)12-8-7-11(9-15-12)13(16)10-5-3-2-4-6-10/h2-9,13,16H,1H3/t13-/m1/s1 |
| InChIKey | OYECEMYHIYCSDK-CYBMUJFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Akanthomyces lecanii (ncbitaxon:2714763) | - | DOI (10.1021/np000094q) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vertilecanin A Methy ester (CHEBI:218050) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| methyl 5-[(R)-hydroxy(phenyl)methyl]pyridine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 8833203 | ChemSpider |