EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O5 |
| Net Charge | 0 |
| Average Mass | 164.157 |
| Monoisotopic Mass | 164.06847 |
| SMILES | [H][C@](O)([C@]([H])(O)[C@@]([H])(O)C=O)[C@@]([H])(C)O |
| WURCS | WURCS=2.0/1,1,0/[o2122m]/1/ |
| InChI | InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4+,5-,6-/m1/s1 |
| InChIKey | PNNNRSAQSRJVSB-JGWLITMVSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-quinovose (CHEBI:28140) is a quinovose (CHEBI:33980) |
| Incoming Relation(s) |
| 6-sulfo-D-quinovose (CHEBI:77198) has functional parent D-quinovose (CHEBI:28140) |
| α-D-quinovopyranose (CHEBI:42606) is a D-quinovose (CHEBI:28140) |
| β-D-quinovofuranose (CHEBI:155508) is a D-quinovose (CHEBI:28140) |
| β-D-quinovopyranose (CHEBI:152156) is a D-quinovose (CHEBI:28140) |
| IUPAC Name |
|---|
| 6-deoxy-D-glucose |
| Synonyms | Source |
|---|---|
| 6-Deoxy-D-glucose | KEGG COMPOUND |
| D-Chinovose | KEGG COMPOUND |
| D-Epifucose | KEGG COMPOUND |
| D-Glucomethylose | KEGG COMPOUND |
| D-Quinovose | KEGG COMPOUND |
| Isorhamnose | KEGG COMPOUND |