EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O5 |
| Net Charge | 0 |
| Average Mass | 164.157 |
| Monoisotopic Mass | 164.06847 |
| SMILES | C[C@@H](O)[C@H]1O[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2122m-1b_1-4]/1/ |
| InChI | InChI=1S/C6H12O5/c1-2(7)5-3(8)4(9)6(10)11-5/h2-10H,1H3/t2-,3-,4-,5-,6-/m1/s1 |
| InChIKey | AFNUZVCFKQUDBJ-QZABAPFNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-quinovofuranose (CHEBI:155508) is a D-quinovose (CHEBI:28140) |
| IUPAC Names |
|---|
| b-Quif |
| 6-deoxy-β-D-glucofuranose |
| Synonyms | Source |
|---|---|
| 6-deoxy-β-D-gluco-hexofuranose | IUPAC |
| β-D-quinovose furanose | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| G98658CV | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| CAS:2096516-70-8 | ChemIDplus |