EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H51N9O15 |
| Net Charge | 0 |
| Average Mass | 825.830 |
| Monoisotopic Mass | 825.35046 |
| SMILES | NC(=O)C[C@H]1NC(=O)[C@H](CCCN(O)C=O)NC(=O)[C@H](NC(=O)C[C@H](O)[C@@H](N)CCCCNC(=O)c2cccc(O)c2O)COC(=O)[C@H](CCCN(O)C=O)NC1=O |
| InChI | InChI=1S/C34H51N9O15/c35-20(7-1-2-11-37-30(51)19-6-3-10-25(46)29(19)50)26(47)15-28(49)38-24-16-58-34(55)22(9-5-13-43(57)18-45)40-32(53)23(14-27(36)48)41-31(52)21(39-33(24)54)8-4-12-42(56)17-44/h3,6,10,17-18,20-24,26,46-47,50,56-57H,1-2,4-5,7-9,11-16,35H2,(H2,36,48)(H,37,51)(H,38,49)(H,39,54)(H,40,53)(H,41,52)/t20-,21-,22-,23+,24+,26-/m0/s1 |
| InChIKey | FFAYQCOAOXEBPN-CXBWMIOTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonasspecies S2B (ncbitaxon:1286359) | - | PubMed (23444833) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lystabactin B (CHEBI:217983) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| N-[(5S,6S)-5-amino-8-[[(3S,6R,9S,12R)-6-(2-amino-2-oxoethyl)-3,9-bis[3-[ormyl(hydroxy)amino]propyl]-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-12-yl]amino]-6-hydroxy-8-oxooctyl]-2,3-dihydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 30770830 | ChemSpider |