EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O4 |
| Net Charge | 0 |
| Average Mass | 318.413 |
| Monoisotopic Mass | 318.18311 |
| SMILES | COC(=O)[C@H]1C[C@@H](C)[C@@H]2[C@@H](/C=C/C=C/C(=O)O)[C@@H](C)C=C[C@H]2C1 |
| InChI | InChI=1S/C19H26O4/c1-12-8-9-14-11-15(19(22)23-3)10-13(2)18(14)16(12)6-4-5-7-17(20)21/h4-9,12-16,18H,10-11H2,1-3H3,(H,20,21)/b6-4+,7-5+/t12-,13+,14-,15-,16-,18-/m0/s1 |
| InChIKey | VARHJRJYCDFTBC-TXDHKASQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (29778575) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanzawaic acid Z (CHEBI:217960) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S,2S,4aR,6S,8R,8aS)-6-methoxycarbonyl-2,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]penta-2,4-dienoic acid |