EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O4 |
| Net Charge | 0 |
| Average Mass | 292.290 |
| Monoisotopic Mass | 292.07356 |
| SMILES | O=C(O)C1=C(c2ccccc2)C(=Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C18H12O4/c19-17(20)16-15(13-9-5-2-6-10-13)14(18(21)22-16)11-12-7-3-1-4-8-12/h1-11H,(H,19,20) |
| InChIKey | HXJRAGITJNXHBB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ralstonia solanacearum (ncbitaxon:305) | - | PubMed (24106142) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ralfuranone I (CHEBI:217944) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| 4-benzylidene-5-oxo-3-phenyluran-2-carboxylic acid |