EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48N4O4S |
| Net Charge | 0 |
| Average Mass | 560.805 |
| Monoisotopic Mass | 560.33963 |
| SMILES | CCC(C)[C@@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1c1nc(C(=O)OC)cs1)C(C)C)N(CC=C(C)C)CC=C(C)C |
| InChI | InChI=1S/C30H48N4O4S/c1-10-22(8)26(33(16-13-19(2)3)17-14-20(4)5)27(35)32-25(21(6)7)29(36)34-15-11-12-24(34)28-31-23(18-39-28)30(37)38-9/h13-14,18,21-22,24-26H,10-12,15-17H2,1-9H3,(H,32,35)/t22?,24-,25-,26-/m0/s1 |
| InChIKey | QGQGLBPVZHTZGT-FYEYIQNQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa (ncbitaxon:1126) | - | DOI (10.1021/jo990247i) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosamide (CHEBI:217934) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| methyl 2-[(2S)-1-[(2S)-2-[[(2S)-2-[bis(3-methylbut-2-enyl)amino]-3-methylpentanoyl]amino]-3-methylbutanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 28283362 | ChemSpider |