EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | COc1cccc2c1[C@@H](O)[C@@]1(O)[C@@H]3Cc4cc(C)cc(O)c4[C@H]1[C@H]2O3 |
| InChI | InChI=1S/C20H20O5/c1-9-6-10-8-14-20(23)17(15(10)12(21)7-9)18(25-14)11-4-3-5-13(24-2)16(11)19(20)22/h3-7,14,17-19,21-23H,8H2,1-2H3/t14-,17-,18-,19+,20+/m0/s1 |
| InChIKey | CXWRZBHQTINGNV-SQWSIXGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseus (ncbitaxon:1911) | - | DOI (10.1016/j.tetlet.2018.04.063) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Kiamycin C (CHEBI:217911) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1S,9S,11R,18R,19R)-16-methoxy-5-methyl-10-oxapentacyclo[9.8.0.02,7.09,19.012,17]nonadeca-2(7),3,5,12(17),13,15-hexaene-3,18,19-triol |
| Manual Xrefs | Databases |
|---|---|
| 71048998 | ChemSpider |