EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO5 |
| Net Charge | 0 |
| Average Mass | 283.324 |
| Monoisotopic Mass | 283.14197 |
| SMILES | CC[C@H](CO)CCc1cc(=O)c(C(=O)O)cn1CCO |
| InChI | InChI=1S/C14H21NO5/c1-2-10(9-17)3-4-11-7-13(18)12(14(19)20)8-15(11)5-6-16/h7-8,10,16-17H,2-6,9H2,1H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | LKAZINBTZKNQAN-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cylindrocarponspecies (ncbitaxon:1756108) | - | PubMed (29778573) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cylindrocarpyridone B (CHEBI:217889) is a aromatic carboxylic acid (CHEBI:33859) |
| Cylindrocarpyridone B (CHEBI:217889) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 1-(2-hydroxyethyl)-6-[3-(hydroxymethyl)pentyl]-4-oxopyridine-3-carboxylic acid |