EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21NO7S |
| Net Charge | 0 |
| Average Mass | 335.378 |
| Monoisotopic Mass | 335.10387 |
| SMILES | COC(=O)[C@H](O)[C@@H](C(=O)SC[C@H](NC(C)=O)C(=O)O)C(C)C |
| InChI | InChI=1S/C13H21NO7S/c1-6(2)9(10(16)12(19)21-4)13(20)22-5-8(11(17)18)14-7(3)15/h6,8-10,16H,5H2,1-4H3,(H,14,15)(H,17,18)/t8-,9-,10+/m0/s1 |
| InChIKey | WSFRAWUTQCKTIT-LPEHRKFASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (20075978) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-69 (CHEBI:217871) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-[(2S,3R)-3-hydroxy-4-methoxy-4-oxo-2-propan-2-ylbutanoyl]sulanylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28287294 | ChemSpider |