EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H49N3O8S |
| Net Charge | 0 |
| Average Mass | 707.890 |
| Monoisotopic Mass | 707.32404 |
| SMILES | COC1C=C/C=C/C=C/CC(OC(=O)C(C)NC(=O)C2=CCCCC2)C(C)C(O)/C(C)=C\CCc2cc3c(c(c2O)NC(=O)C1)SCC(=O)N3 |
| InChI | InChI=1S/C38H49N3O8S/c1-23-14-13-17-27-20-29-36(50-22-32(43)40-29)33(35(27)45)41-31(42)21-28(48-4)18-11-6-5-7-12-19-30(24(2)34(23)44)49-38(47)25(3)39-37(46)26-15-9-8-10-16-26/h5-7,11-12,14-15,18,20,24-25,28,30,34,44-45H,8-10,13,16-17,19,21-22H2,1-4H3,(H,39,46)(H,40,43)(H,41,42)/b6-5+,12-7+,18-11?,23-14- |
| InChIKey | SLZPTPUBMSQVAK-BKOAXCBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (7622432) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiazinotrienomycin A (CHEBI:217864) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(4Z,10E,12E)-6,28-dihydroxy-16-methoxy-5,7-dimethyl-18,24-dioxo-22-thia-19,25-diazatricyclo[18.7.1.021,26]octacosa-1(27),4,10,12,14,20(28),21(26)-heptaen-8-yl] 2-(cyclohexene-1-carbonylamino)propanoate |