EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H68N4O8 |
| Net Charge | 0 |
| Average Mass | 733.004 |
| Monoisotopic Mass | 732.50372 |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@H](C(=O)N(C)[C@@H](C(C)C)[C@@H](CC(=O)N1CCC[C@H]1[C@H](OC)[C@@H](C)C(=O)O[C@H](CO)Cc1ccccc1)OC)C(C)C)N(C)C |
| InChI | InChI=1S/C40H68N4O8/c1-13-27(6)36(42(8)9)38(47)41-34(25(2)3)39(48)43(10)35(26(4)5)32(50-11)23-33(46)44-21-17-20-31(44)37(51-12)28(7)40(49)52-30(24-45)22-29-18-15-14-16-19-29/h14-16,18-19,25-28,30-32,34-37,45H,13,17,20-24H2,1-12H3,(H,41,47)/t27-,28+,30-,31-,32+,34-,35-,36-,37+/m0/s1 |
| InChIKey | LERBYHJLOKXDNI-UUFHNPECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symploca hydnoides (ncbitaxon:207924) | - | DOI (10.1021/np010560r) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malevamide D (CHEBI:217810) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [(2S)-1-hydroxy-3-phenylpropan-2-yl] (2R,3R)-3-[(2S)-1-[(3R,4S)-4-[[(2S)-2-[[(2S,3S)-2-(dimethylamino)-3-methylpentanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylhexanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 552443 | ChemSpider |