EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | CC(=O)OCc1ccc(COC(C)=O)o1 |
| InChI | InChI=1S/C10H12O5/c1-7(11)13-5-9-3-4-10(15-9)6-14-8(2)12/h3-4H,5-6H2,1-2H3 |
| InChIKey | UQYIJQXDRBKHBG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (18715034) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-bis(hydroxymethyl)furan diacetate (CHEBI:217784) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [5-(acetyloxymethyl)uran-2-yl]methyl acetate |
| Manual Xrefs | Databases |
|---|---|
| 3292064 | ChemSpider |