EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O7 |
| Net Charge | 0 |
| Average Mass | 296.275 |
| Monoisotopic Mass | 296.08960 |
| SMILES | COc1c(C)cc(C(=O)OC[C@H](O)CO)c2c1C(=O)OC2 |
| InChI | InChI=1S/C14H16O7/c1-7-3-9(13(17)20-5-8(16)4-15)10-6-21-14(18)11(10)12(7)19-2/h3,8,15-16H,4-6H2,1-2H3/t8-/m1/s1 |
| InChIKey | MDQMINVPLUMWIC-MRVPVSSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diaporthe (ncbitaxon:36922) | - | PubMed (29660469) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (13R)-diaporphthalide A (CHEBI:217742) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| [(2R)-2,3-dihydroxypropyl] 7-methoxy-6-methyl-1-oxo-3H-2-benzouran-4-carboxylate |