EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H44N8O11 |
| Net Charge | 0 |
| Average Mass | 620.661 |
| Monoisotopic Mass | 620.31295 |
| SMILES | CN[C@@H](CCCN(O)C(=O)[C@H](CO)NC(=O)[C@H](CCCN(O)C=O)NC)C(=O)N[C@@H](CO)C(=O)N[C@@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C24H44N8O11/c1-25-15(6-3-9-30(41)14-35)21(37)29-19(13-34)24(40)32(43)10-4-7-16(26-2)20(36)28-18(12-33)22(38)27-17-8-5-11-31(42)23(17)39/h14-19,25-26,33-34,41-43H,3-13H2,1-2H3,(H,27,38)(H,28,36)(H,29,37)/t15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | YULDEEYZYIPNOT-OYSTVDSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (23752895) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Turgichelin (CHEBI:217708) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-5-[ormyl(hydroxy)amino]-N-[(2S)-3-hydroxy-1-[hydroxy-[(4S)-5-[[(2S)-3-hydroxy-1-[[(3R)-1-hydroxy-2-oxopiperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-4-(methylamino)-5-oxopentyl]amino]-1-oxopropan-2-yl]-2-(methylamino)pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 78440501 | ChemSpider |