EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O7 |
| Net Charge | 0 |
| Average Mass | 394.379 |
| Monoisotopic Mass | 394.10525 |
| SMILES | CC(C)C(=O)O[C@@H]1c2c(cc(O)c3c2C(=O)c2cccc(O)c2-3)C(=O)[C@@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C22H18O7/c1-8(2)21(27)28-18-14-10(19(26)22(3)20(18)29-22)7-12(24)15-13-9(17(25)16(14)15)5-4-6-11(13)23/h4-8,18,20,23-24H,1-3H3/t18-,20+,22-/m1/s1 |
| InChIKey | UIKYAUSFWRLFDK-KAGYGMCKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (16629411) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluostatin D (CHEBI:217677) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| [(3R,4S,6S)-10,13-dihydroxy-6-methyl-7,18-dioxo-5-oxapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1,8,10,12(17),13,15-hexaen-3-yl] 2-methylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 9885659 | ChemSpider |