EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15N3O3 |
| Net Charge | 0 |
| Average Mass | 357.369 |
| Monoisotopic Mass | 357.11134 |
| SMILES | O=C(O)C1=Cc2c(nc3ccccc23)C(=O)[C@H](c2cnc3ccccc23)N1 |
| InChI | InChI=1S/C21H15N3O3/c25-20-18-13(11-5-2-4-8-16(11)23-18)9-17(21(26)27)24-19(20)14-10-22-15-7-3-1-6-12(14)15/h1-10,19,22-24H,(H,26,27)/t19-/m0/s1 |
| InChIKey | WAYCTJIOHZZDEI-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chromobacterium violaceum (ncbitaxon:536) | - | PubMed (20490411) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chromoazepinone A (CHEBI:217661) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 4-(1H-indol-3-yl)-5-oxo-4,6-dihydro-3H-azepino[4,5-b]indole-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 24582479 | ChemSpider |