EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H59Cl2N5O8 |
| Net Charge | 0 |
| Average Mass | 772.812 |
| Monoisotopic Mass | 771.37407 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](O)[C@H](N)CCCCCCC(Cl)Cl)C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C37H59Cl2N5O8/c1-6-23(4)31(42-34(48)32(46)26(40)12-9-7-8-10-14-30(38)39)36(50)43(5)29(20-22(2)3)35(49)44-19-11-13-28(44)33(47)41-27(37(51)52)21-24-15-17-25(45)18-16-24/h15-18,22-23,26-32,45-46H,6-14,19-21,40H2,1-5H3,(H,41,47)(H,42,48)(H,51,52)/t23-,26+,27-,28-,29-,31-,32+/m0/s1 |
| InChIKey | AJANMHKQVWDPQL-OBYHAHFLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/s0040-4020(00)00770-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin 91-E (CHEBI:217642) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-1-[(2S)-2-[[(2S,3S)-2-[[(2R,3R)-3-amino-10,10-dichloro-2-hydroxydecanoyl]amino]-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8548477 | ChemSpider |