EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H41ClN2O7 |
| Net Charge | 0 |
| Average Mass | 625.162 |
| Monoisotopic Mass | 624.26023 |
| SMILES | COc1ccc(C[C@H]2NC(=O)/C=C/C[C@@H](C/C=C/c3ccccc3)OC(=O)[C@H](CC(C)C)OC(=O)[C@H](C)CNC2=O)cc1Cl |
| InChI | InChI=1S/C34H41ClN2O7/c1-22(2)18-30-34(41)43-26(13-8-12-24-10-6-5-7-11-24)14-9-15-31(38)37-28(32(39)36-21-23(3)33(40)44-30)20-25-16-17-29(42-4)27(35)19-25/h5-12,15-17,19,22-23,26,28,30H,13-14,18,20-21H2,1-4H3,(H,36,39)(H,37,38)/b12-8+,15-9+/t23-,26-,28-,30+/m1/s1 |
| InChIKey | YMZVKVLSUBCSND-DWEOSBBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostoc (ncbitaxon:1177) | - | DOI (10.1021/ja00154a002) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cryptophycin-28 (CHEBI:217640) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S,6R,10R,13E,16R)-10-[(3-chloro-4-methoxyphenyl)methyl]-6-methyl-3-(2-methylpropyl)-16-[(E)-3-phenylprop-2-enyl]-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 8683583 | ChemSpider |