EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O4 |
| Net Charge | 0 |
| Average Mass | 420.549 |
| Monoisotopic Mass | 420.23006 |
| SMILES | CC(=O)/C(C)=C/C=C/C=C\C=C\C=C\C=C\C=C\C=C\C=C\C=C\C[C@H](O)CC(=O)O |
| InChI | InChI=1S/C27H32O4/c1-24(25(2)28)21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-26(29)23-27(30)31/h3-21,26,29H,22-23H2,1-2H3,(H,30,31)/b4-3+,7-5+,8-6+,11-9+,12-10+,15-13-,16-14+,19-17+,20-18+,24-21+/t26-/m0/s1 |
| InChIKey | KTAMMGIWIFDREV-NRJOTUGDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laetiporus sulphureus (ncbitaxon:5630) | - | DOI (10.1016/j.tetlet.2003.11.073) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-trans-Laetiporic acid (CHEBI:217623) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (5E,7E,9E,11E,13E,15E,17E,19Z,21E,23E)-3-hydroxy-24-methyl-25-oxohexacosa-5,7,9,11,13,15,17,19,21,23-decaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434887 | ChemSpider |