EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37N5O7 |
| Net Charge | 0 |
| Average Mass | 519.599 |
| Monoisotopic Mass | 519.26930 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C25H37N5O7/c1-14(2)12-19(24(35)30-11-3-4-20(30)25(36)37)29-23(34)18(9-10-21(27)32)28-22(33)17(26)13-15-5-7-16(31)8-6-15/h5-8,14,17-20,31H,3-4,9-13,26H2,1-2H3,(H2,27,32)(H,28,33)(H,29,34)(H,36,37)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | ZODVQAQTYNSMAA-MUGJNUQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | - | PubMed (29474977) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-1-[(2S)-2-[[(2S)-5-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid (CHEBI:217611) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-[[(2S)-5-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 71044323 | ChemSpider |