EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O7 |
| Net Charge | 0 |
| Average Mass | 446.540 |
| Monoisotopic Mass | 446.23045 |
| SMILES | CCC(C)CC(C)C(=O)OC1(C)C(=O)c2c(cc(O)c3c2C[C@@H](O)C[C@H]3C)C(C)(O)C1=O |
| InChI | InChI=1S/C25H34O7/c1-7-12(2)8-14(4)22(29)32-25(6)21(28)20-16-10-15(26)9-13(3)19(16)18(27)11-17(20)24(5,31)23(25)30/h11-15,26-27,31H,7-10H2,1-6H3/t12?,13-,14?,15+,24?,25?/m1/s1 |
| InChIKey | LCCGEVUWWBLMGC-PYFURSOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromycesspecies (ncbitaxon:1707706) | - | PubMed (26271586) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vanitaracin A (CHEBI:217568) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| [(6S,8R)-1,6,9-trihydroxy-1,3,8-trimethyl-2,4-dioxo-5,6,7,8-tetrahydrophenanthren-3-yl] 2,4-dimethylhexanoate |