EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46N6O8 |
| Net Charge | 0 |
| Average Mass | 690.798 |
| Monoisotopic Mass | 690.33771 |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)CCCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C36H46N6O8/c37-36(38)39-19-5-9-28(40-32(46)10-4-8-23-11-15-26(43)16-12-23)34(48)42-29(20-24-6-2-1-3-7-24)31(45)22-33(47)41-30(35(49)50)21-25-13-17-27(44)18-14-25/h1-3,6-7,11-18,28-31,43-45H,4-5,8-10,19-22H2,(H,40,46)(H,41,47)(H,42,48)(H,49,50)(H4,37,38,39)/t28-,29+,30+,31+/m1/s1 |
| InChIKey | ORWSPLPFCCECQV-BHSUFKTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stictaspecies (ncbitaxon:2012247) | - | PubMed (21500817) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stictamide B (CHEBI:217561) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(3S,4S)-4-[[(2R)-5-(diaminomethylideneamino)-2-[4-(4-hydroxyphenyl)butanoylamino]pentanoyl]amino]-3-hydroxy-5-phenylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 25948197 | ChemSpider |