EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N2O2 |
| Net Charge | 0 |
| Average Mass | 160.217 |
| Monoisotopic Mass | 160.12118 |
| SMILES | CN[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C7H16N2O2/c1-9-6(7(10)11)4-2-3-5-8/h6,9H,2-5,8H2,1H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | OLYPWXRMOFUVGH-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-methyl-L-lysine (CHEBI:21756) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| N2-methyl-L-lysine (CHEBI:21756) is a L-lysine derivative (CHEBI:25095) |
| IUPAC Name |
|---|
| N2-methyl-L-lysine |
| Synonym | Source |
|---|---|
| Nα-methyl-L-lysine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723102 | Reaxys |