EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15ClO4 |
| Net Charge | 0 |
| Average Mass | 258.701 |
| Monoisotopic Mass | 258.06589 |
| SMILES | CCCc1c(Cl)c(OC)cc(OC)c1C(=O)O |
| InChI | InChI=1S/C12H15ClO4/c1-4-5-7-10(12(14)15)8(16-2)6-9(17-3)11(7)13/h6H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | MEDZQTPQXJJSOI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremoniumspecies (ncbitaxon:2046025) | - | PubMed (18197603) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acremonisol A (CHEBI:217524) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 3-chloro-4,6-dimethoxy-2-propylbenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 27023198 | ChemSpider |