EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO6 |
| Net Charge | 0 |
| Average Mass | 345.351 |
| Monoisotopic Mass | 345.12124 |
| SMILES | C=C1OC(=O)c2c(O)cc(O)c(CN3C(=O)CC[C@@H]3C(C)=O)c2[C@@H]1C |
| InChI | InChI=1S/C18H19NO6/c1-8-10(3)25-18(24)17-14(22)6-13(21)11(16(8)17)7-19-12(9(2)20)4-5-15(19)23/h6,8,12,21-22H,3-5,7H2,1-2H3/t8-,12-/m1/s1 |
| InChIKey | IDUXYDXYBIDYKD-PRHODGIISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraphaeosphaeria (ncbitaxon:125369) | - | DOI (10.1016/j.tetlet.2017.02.052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphaerialactonam (CHEBI:217484) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (5R)-5-acetyl-1-[[(4S)-6,8-dihydroxy-4-methyl-3-methylidene-1-oxo-4H-isochromen-5-yl]methyl]pyrrolidin-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78439380 | ChemSpider |