EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:217482 - 3-(3-hydroxy-2-(hydroxymethyl)phenyl)propanoic acid
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | O=C(O)CCc1cccc(O)c1CO |
| InChI | InChI=1S/C10H12O4/c11-6-8-7(4-5-10(13)14)2-1-3-9(8)12/h1-3,11-12H,4-6H2,(H,13,14) |
| InChIKey | IZFIFPWUMYOFTJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum (ncbitaxon:5455) | - | PubMed (32216287) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3-hydroxy-2-(hydroxymethyl)phenyl)propanoic acid (CHEBI:217482) is a benzenes (CHEBI:22712) |
| 3-(3-hydroxy-2-(hydroxymethyl)phenyl)propanoic acid (CHEBI:217482) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-[3-hydroxy-2-(hydroxymethyl)phenyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23339780 | ChemSpider |