EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34N4O6 |
| Net Charge | 0 |
| Average Mass | 450.536 |
| Monoisotopic Mass | 450.24783 |
| SMILES | CC(C)C(NC(=O)C(NC(=O)[C@H](C)N)C(C)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H34N4O6/c1-11(2)17(26-21(30)18(12(3)4)25-19(28)13(5)23)20(29)24-16(22(31)32)10-14-6-8-15(27)9-7-14/h6-9,11-13,16-18,27H,10,23H2,1-5H3,(H,24,29)(H,25,28)(H,26,30)(H,31,32)/t13-,16+,17?,18?/m0/s1 |
| InChIKey | LODIJGLULWBSDS-WGEBEKNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1016/j.tetlet.2017.02.005) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergillide G (CHEBI:217451) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2R)-2-[[2-[[2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 61360302 | ChemSpider |