EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N4O5 |
| Net Charge | 0 |
| Average Mass | 466.538 |
| Monoisotopic Mass | 466.22162 |
| SMILES | CC(C)[C@@H](NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C25H30N4O5/c1-14(2)22(25(33)34)29-24(32)21(12-16-13-27-20-6-4-3-5-18(16)20)28-23(31)19(26)11-15-7-9-17(30)10-8-15/h3-10,13-14,19,21-22,27,30H,11-12,26H2,1-2H3,(H,28,31)(H,29,32)(H,33,34)/t19-,21-,22+/m0/s1 |
| InChIKey | JRMCISZDVLOTLR-ILWGZMRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1016/j.tetlet.2017.02.005) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergillide E (CHEBI:217439) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 61360300 | ChemSpider |