EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H42Cl2N4O8 |
| Net Charge | 0 |
| Average Mass | 681.614 |
| Monoisotopic Mass | 680.23797 |
| SMILES | CN(C(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C(O)C(N)CCCCC(Cl)Cl)[C@@H](Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C32H42Cl2N4O8/c1-37(26(18-20-10-14-22(40)15-11-20)31(44)38-16-4-6-25(38)32(45)46)30(43)24(17-19-8-12-21(39)13-9-19)36-29(42)28(41)23(35)5-2-3-7-27(33)34/h8-15,23-28,39-41H,2-7,16-18,35H2,1H3,(H,36,42)(H,45,46)/t23?,24-,25-,26-,28?/m0/s1 |
| InChIKey | NGZPFBMYYAIAEL-SBMNFUEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa (ncbitaxon:1126) | - | DOI (10.1016/j.tetlet.2016.03.039) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin 680 (CHEBI:217393) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-[[(2S)-2-[(3-amino-8,8-dichloro-2-hydroxyoctanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442715 | ChemSpider |