EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46O4 |
| Net Charge | 0 |
| Average Mass | 482.705 |
| Monoisotopic Mass | 482.33961 |
| SMILES | CO[C@H]1O[C@H]2CC[C@@]13C1=C(CC[C@H]3C2(C)C)[C@]2(C)CC[C@H]([C@H](C)[C@H]3CC=C(C)C(=O)O3)[C@@]2(C)CC1 |
| InChI | InChI=1S/C31H46O4/c1-18-8-10-23(34-26(18)32)19(2)20-12-15-30(6)21-9-11-24-28(3,4)25-14-17-31(24,27(33-7)35-25)22(21)13-16-29(20,30)5/h8,19-20,23-25,27H,9-17H2,1-7H3/t19-,20+,23+,24-,25-,27-,29+,30-,31-/m0/s1 |
| InChIKey | IFLVEWDKEALXIO-PHKMFKKMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma (ncbitaxon:5314) | - | PubMed (18451550) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colobetaolactone III (CHEBI:217371) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (2R)-2-[(1S)-1-[(1R,5R,6R,9R,13S,15S,17S)-17-methoxy-5,9,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadec-2(10)-en-6-yl]ethyl]-5-methyl-2,3-dihydropyran-6-one |