EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O |
| Net Charge | 0 |
| Average Mass | 270.416 |
| Monoisotopic Mass | 270.19837 |
| SMILES | C=C[C@@]1(C)C=C2C(=O)C[C@H]3C(=C2CC1)CCCC3(C)C |
| InChI | InChI=1S/C19H26O/c1-5-19(4)10-8-13-14-7-6-9-18(2,3)16(14)11-17(20)15(13)12-19/h5,12,16H,1,6-11H2,2-4H3/t16-,19+/m0/s1 |
| InChIKey | KZKITUJEMKMAJV-QFBILLFUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diplodia corticola (ncbitaxon:236234) | - | DOI (10.1016/j.tet.2016.09.008) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphaeropsidin G (CHEBI:217330) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (7S,10aR)-7-ethenyl-1,1,7-trimethyl-3,4,5,6,10,10a-hexahydro-2H-phenanthren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 78437577 | ChemSpider |